C30H43Cl3N2O7S — CID 91052356
(6R,8S,15S)-15-amino-3-hydroxy-4,4,6,8,12,16-hexamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)heptadeca-10,12,16-trienoic acid (PubChem CID 91052356) has the molecular formula C30H43Cl3N2O7S and a molecular weight of 682.11 g/mol. Its IUPAC name is (6R,8S,15S)-15-amino-3-hydroxy-4,4,6,8,12,16-hexamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)heptadeca-10,12,16-trienoic acid.
| Compound Name | (6R,8S,15S)-15-amino-3-hydroxy-4,4,6,8,12,16-hexamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)heptadeca-10,12,16-trienoic acid |
|---|---|
| PubChem CID | 91052356 |
| Molecular Formula | C30H43Cl3N2O7S |
| Molecular Weight | 682.11 g/mol |
| Exact Mass | 680.19 |
| IUPAC Name | (6R,8S,15S)-15-amino-3-hydroxy-4,4,6,8,12,16-hexamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)heptadeca-10,12,16-trienoic acid |
| SMILES | CC(C=CC[C@H](C)C(OC(=O)OCC(Cl)(Cl)Cl)[C@@H](C)C(=O)C(C)(C)C(O)CC(=O)O)=CC[C@H](N)C(C)=Cc1csc(C)n1 |
| InChI | InChI=1S/C30H43Cl3N2O7S/c1-17(11-12-23(34)19(3)13-22-15-43-21(5)35-22)9-8-10-18(2)26(42-28(40)41-16-30(31,32)33)20(4)27(39)29(6,7)24(36)14-25(37)38/h8-9,11,13,15,18,20,23-24,26,36H,10,12,14,16,34H2,1-7H3,(H,37,38)/t18-,20+,23-,24?,26?/m0/s1 |
| InChIKey | JWQOYZKVTRMZRY-JSEGOIJSSA-N |
| XLogP | 7.06 |
| TPSA | 149.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.11 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|