C27H44N2O6S — CID 10305618
(3S,6R,7S,8S)-11-[(2R,3S)-3-[(E,2S)-2-amino-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid (PubChem CID 10305618) has the molecular formula C27H44N2O6S and a molecular weight of 524.72 g/mol. Its IUPAC name is (3S,6R,7S,8S)-11-[(2R,3S)-3-[(E,2S)-2-amino-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid.
| Compound Name | (3S,6R,7S,8S)-11-[(2R,3S)-3-[(E,2S)-2-amino-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid |
|---|---|
| PubChem CID | 10305618 |
| Molecular Formula | C27H44N2O6S |
| Molecular Weight | 524.72 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | (3S,6R,7S,8S)-11-[(2R,3S)-3-[(E,2S)-2-amino-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid |
| SMILES | C/C(=C\c1csc(C)n1)[C@@H](N)C[C@@H]1O[C@]1(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C27H44N2O6S/c1-15(24(33)17(3)25(34)26(5,6)21(30)13-23(31)32)9-8-10-27(7)22(35-27)12-20(28)16(2)11-19-14-36-18(4)29-19/h11,14-15,17,20-22,24,30,33H,8-10,12-13,28H2,1-7H3,(H,31,32)/b16-11+/t15-,17+,20-,21-,22-,24-,27+/m0/s1 |
| InChIKey | SMAHNMGLCJLZOA-PVYNADRNSA-N |
| XLogP | 3.96 |
| TPSA | 146.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.72 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|