C28H43NO5S — CID 177408531
[(1Z,3S)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hexa-1,5-dien-3-yl] (3S,6R,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxotridec-12-enoate (PubChem CID 177408531) has the molecular formula C28H43NO5S and a molecular weight of 505.72 g/mol. Its IUPAC name is [(1Z,3S)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hexa-1,5-dien-3-yl] (3S,6R,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxotridec-12-enoate.
| Compound Name | [(1Z,3S)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hexa-1,5-dien-3-yl] (3S,6R,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxotridec-12-enoate |
|---|---|
| PubChem CID | 177408531 |
| Molecular Formula | C28H43NO5S |
| Molecular Weight | 505.72 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | [(1Z,3S)-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hexa-1,5-dien-3-yl] (3S,6R,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxotridec-12-enoate |
| SMILES | C=CCCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O[C@@H](CC=C)/C(C)=C\c1csc(C)n1 |
| InChI | InChI=1S/C28H43NO5S/c1-9-11-12-14-18(3)26(32)20(5)27(33)28(7,8)24(30)16-25(31)34-23(13-10-2)19(4)15-22-17-35-21(6)29-22/h9-10,15,17-18,20,23-24,26,30,32H,1-2,11-14,16H2,3-8H3/b19-15-/t18-,20+,23-,24-,26-/m0/s1 |
| InChIKey | PSAUTUXJQZOIGL-ZQUWVOSOSA-N |
| XLogP | 5.68 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.72 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|