C28H45NO5S — CID 89176142
[(E,2S)-1-[(2R)-2-[(4S,5S,6R)-5-hydroxy-4,6-dimethyl-7-oxoheptyl]cyclopropyl]-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-en-2-yl] (3S)-3-hydroxy-4,4-dimethylpentanoate (PubChem CID 89176142) has the molecular formula C28H45NO5S and a molecular weight of 507.74 g/mol. Its IUPAC name is [(E,2S)-1-[(2R)-2-[(4S,5S,6R)-5-hydroxy-4,6-dimethyl-7-oxoheptyl]cyclopropyl]-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-en-2-yl] (3S)-3-hydroxy-4,4-dimethylpentanoate.
| Compound Name | [(E,2S)-1-[(2R)-2-[(4S,5S,6R)-5-hydroxy-4,6-dimethyl-7-oxoheptyl]cyclopropyl]-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-en-2-yl] (3S)-3-hydroxy-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 89176142 |
| Molecular Formula | C28H45NO5S |
| Molecular Weight | 507.74 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | [(E,2S)-1-[(2R)-2-[(4S,5S,6R)-5-hydroxy-4,6-dimethyl-7-oxoheptyl]cyclopropyl]-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-en-2-yl] (3S)-3-hydroxy-4,4-dimethylpentanoate |
| SMILES | C/C(=C\c1csc(C)n1)[C@H](CC1C[C@H]1CCC[C@H](C)[C@H](O)C(C)C=O)OC(=O)C[C@H](O)C(C)(C)C |
| InChI | InChI=1S/C28H45NO5S/c1-17(27(33)19(3)15-30)9-8-10-21-12-22(21)13-24(18(2)11-23-16-35-20(4)29-23)34-26(32)14-25(31)28(5,6)7/h11,15-17,19,21-22,24-25,27,31,33H,8-10,12-14H2,1-7H3/b18-11+/t17-,19?,21+,22?,24-,25-,27-/m0/s1 |
| InChIKey | FXNBOYDXNYWTFQ-HPAVAGQOSA-N |
| XLogP | 5.59 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.74 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|