C30H45NO4S — CID 59097713
[(1E,3S,5Z)-2,6-dimethyl-1-(2-methyl-1,3-thiazol-4-yl)octa-1,5,7-trien-3-yl] (3S,6R,7S,8S)-3-hydroxy-4,4,6,7,8-pentamethyl-5-oxoundec-10-enoate (PubChem CID 59097713) has the molecular formula C30H45NO4S and a molecular weight of 515.76 g/mol. Its IUPAC name is [(1E,3S,5Z)-2,6-dimethyl-1-(2-methyl-1,3-thiazol-4-yl)octa-1,5,7-trien-3-yl] (3S,6R,7S,8S)-3-hydroxy-4,4,6,7,8-pentamethyl-5-oxoundec-10-enoate.
| Compound Name | [(1E,3S,5Z)-2,6-dimethyl-1-(2-methyl-1,3-thiazol-4-yl)octa-1,5,7-trien-3-yl] (3S,6R,7S,8S)-3-hydroxy-4,4,6,7,8-pentamethyl-5-oxoundec-10-enoate |
|---|---|
| PubChem CID | 59097713 |
| Molecular Formula | C30H45NO4S |
| Molecular Weight | 515.76 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | [(1E,3S,5Z)-2,6-dimethyl-1-(2-methyl-1,3-thiazol-4-yl)octa-1,5,7-trien-3-yl] (3S,6R,7S,8S)-3-hydroxy-4,4,6,7,8-pentamethyl-5-oxoundec-10-enoate |
| SMILES | C=CC[C@H](C)[C@H](C)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O[C@@H](C/C=C(/C)C=C)/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C30H45NO4S/c1-11-13-20(4)22(6)23(7)29(34)30(9,10)27(32)17-28(33)35-26(15-14-19(3)12-2)21(5)16-25-18-36-24(8)31-25/h11-12,14,16,18,20,22-23,26-27,32H,1-2,13,15,17H2,3-10H3/b19-14-,21-16+/t20-,22-,23+,26-,27-/m0/s1 |
| InChIKey | FJZKGLVQMTVGTO-ZPVUKGKYSA-N |
| XLogP | 7.12 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.76 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|