C29H47NO2S — CID 59638846
[(1E,3R,5Z,11S,12R,13R)-2,6,11,12,13,14,14-heptamethyl-1-(2-methyl-1,3-thiazol-4-yl)hexadeca-1,5,15-trien-3-yl] acetate (PubChem CID 59638846) has the molecular formula C29H47NO2S and a molecular weight of 473.77 g/mol. Its IUPAC name is [(1E,3R,5Z,11S,12R,13R)-2,6,11,12,13,14,14-heptamethyl-1-(2-methyl-1,3-thiazol-4-yl)hexadeca-1,5,15-trien-3-yl] acetate.
| Compound Name | [(1E,3R,5Z,11S,12R,13R)-2,6,11,12,13,14,14-heptamethyl-1-(2-methyl-1,3-thiazol-4-yl)hexadeca-1,5,15-trien-3-yl] acetate |
|---|---|
| PubChem CID | 59638846 |
| Molecular Formula | C29H47NO2S |
| Molecular Weight | 473.77 g/mol |
| Exact Mass | 473.33 |
| IUPAC Name | [(1E,3R,5Z,11S,12R,13R)-2,6,11,12,13,14,14-heptamethyl-1-(2-methyl-1,3-thiazol-4-yl)hexadeca-1,5,15-trien-3-yl] acetate |
| SMILES | C=CC(C)(C)[C@H](C)[C@H](C)[C@@H](C)CCCC/C(C)=C\C[C@@H](OC(C)=O)/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C29H47NO2S/c1-11-29(9,10)24(6)23(5)21(3)15-13-12-14-20(2)16-17-28(32-26(8)31)22(4)18-27-19-33-25(7)30-27/h11,16,18-19,21,23-24,28H,1,12-15,17H2,2-10H3/b20-16-,22-18+/t21-,23+,24+,28+/m0/s1 |
| InChIKey | AWHHIGUBYWQHAV-JSFDRWFUSA-N |
| XLogP | 8.80 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.77 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|