C46H87NO5SSi3 — CID 90813669
(15S)-3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-6-ethyl-4,4,8,12,16-pentamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxoheptadeca-12,16-dienal (PubChem CID 90813669) has the molecular formula C46H87NO5SSi3 and a molecular weight of 850.53 g/mol. Its IUPAC name is (15S)-3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-6-ethyl-4,4,8,12,16-pentamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxoheptadeca-12,16-dienal.
| Compound Name | (15S)-3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-6-ethyl-4,4,8,12,16-pentamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxoheptadeca-12,16-dienal |
|---|---|
| PubChem CID | 90813669 |
| Molecular Formula | C46H87NO5SSi3 |
| Molecular Weight | 850.53 g/mol |
| Exact Mass | 849.56 |
| IUPAC Name | (15S)-3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-6-ethyl-4,4,8,12,16-pentamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxoheptadeca-12,16-dienal |
| SMILES | CCC(C(=O)C(C)(C)C(CC=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(C)CCCC(C)=CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)=Cc1csc(C)n1 |
| InChI | InChI=1S/C46H87NO5SSi3/c1-23-38(42(49)46(15,16)40(29-30-48)51-55(19,20)44(9,10)11)41(52-56(21,22)45(12,13)14)34(3)26-24-25-33(2)27-28-39(50-54(17,18)43(6,7)8)35(4)31-37-32-53-36(5)47-37/h27,30-32,34,38-41H,23-26,28-29H2,1-22H3/t34?,38?,39-,40?,41?/m0/s1 |
| InChIKey | VWLMWUWHQJHLFR-MKVFCHFISA-N |
| XLogP | 14.38 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.53 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|