C49H87NO5Si3 — CID 142652863
3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-6-but-3-ynyl-4,4,8,12,16-pentamethyl-5-oxo-17-pyridin-2-ylheptadeca-12,16-dienal (PubChem CID 142652863) has the molecular formula C49H87NO5Si3 and a molecular weight of 854.50 g/mol. Its IUPAC name is 3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-6-but-3-ynyl-4,4,8,12,16-pentamethyl-5-oxo-17-pyridin-2-ylheptadeca-12,16-dienal.
| Compound Name | 3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-6-but-3-ynyl-4,4,8,12,16-pentamethyl-5-oxo-17-pyridin-2-ylheptadeca-12,16-dienal |
|---|---|
| PubChem CID | 142652863 |
| Molecular Formula | C49H87NO5Si3 |
| Molecular Weight | 854.50 g/mol |
| Exact Mass | 853.59 |
| IUPAC Name | 3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-6-but-3-ynyl-4,4,8,12,16-pentamethyl-5-oxo-17-pyridin-2-ylheptadeca-12,16-dienal |
| SMILES | C#CCCC(C(=O)C(C)(C)C(CC=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(C)CCCC(C)=CCC(O[Si](C)(C)C(C)(C)C)C(C)=Cc1ccccn1 |
| InChI | InChI=1S/C49H87NO5Si3/c1-22-23-30-41(45(52)49(14,15)43(33-35-51)54-57(18,19)47(8,9)10)44(55-58(20,21)48(11,12)13)38(3)28-26-27-37(2)31-32-42(53-56(16,17)46(5,6)7)39(4)36-40-29-24-25-34-50-40/h1,24-25,29,31,34-36,38,41-44H,23,26-28,30,32-33H2,2-21H3 |
| InChIKey | QTSAEVLPTBQLDF-UHFFFAOYSA-N |
| XLogP | 14.01 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.50 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|