C35H45NO2Si — CID 173113958
(10E)-9-[tert-butyl(diphenyl)silyl]oxy-2,6,10-trimethyl-11-pyridin-2-ylundeca-6,10-dienal (PubChem CID 173113958) has the molecular formula C35H45NO2Si and a molecular weight of 539.84 g/mol. Its IUPAC name is (10E)-9-[tert-butyl(diphenyl)silyl]oxy-2,6,10-trimethyl-11-pyridin-2-ylundeca-6,10-dienal.
| Compound Name | (10E)-9-[tert-butyl(diphenyl)silyl]oxy-2,6,10-trimethyl-11-pyridin-2-ylundeca-6,10-dienal |
|---|---|
| PubChem CID | 173113958 |
| Molecular Formula | C35H45NO2Si |
| Molecular Weight | 539.84 g/mol |
| Exact Mass | 539.32 |
| IUPAC Name | (10E)-9-[tert-butyl(diphenyl)silyl]oxy-2,6,10-trimethyl-11-pyridin-2-ylundeca-6,10-dienal |
| SMILES | CC(=CCC(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)/C(C)=C/c1ccccn1)CCCC(C)C=O |
| InChI | InChI=1S/C35H45NO2Si/c1-28(16-15-17-29(2)27-37)23-24-34(30(3)26-31-18-13-14-25-36-31)38-39(35(4,5)6,32-19-9-7-10-20-32)33-21-11-8-12-22-33/h7-14,18-23,25-27,29,34H,15-17,24H2,1-6H3/b28-23?,30-26+ |
| InChIKey | ZCFPCSAJLUBYSD-XAFYOCOZSA-N |
| XLogP | 7.77 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.84 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|