C30H36ClNO3SSi — CID 90979797
ethyl 5-[tert-butyl(diphenyl)silyl]oxy-2-chloro-6-methyl-7-(2-methyl-1,3-thiazol-4-yl)hepta-2,6-dienoate (PubChem CID 90979797) has the molecular formula C30H36ClNO3SSi and a molecular weight of 554.23 g/mol. Its IUPAC name is ethyl 5-[tert-butyl(diphenyl)silyl]oxy-2-chloro-6-methyl-7-(2-methyl-1,3-thiazol-4-yl)hepta-2,6-dienoate.
| Compound Name | ethyl 5-[tert-butyl(diphenyl)silyl]oxy-2-chloro-6-methyl-7-(2-methyl-1,3-thiazol-4-yl)hepta-2,6-dienoate |
|---|---|
| PubChem CID | 90979797 |
| Molecular Formula | C30H36ClNO3SSi |
| Molecular Weight | 554.23 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | ethyl 5-[tert-butyl(diphenyl)silyl]oxy-2-chloro-6-methyl-7-(2-methyl-1,3-thiazol-4-yl)hepta-2,6-dienoate |
| SMILES | CCOC(=O)C(Cl)=CCC(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)=Cc1csc(C)n1 |
| InChI | InChI=1S/C30H36ClNO3SSi/c1-7-34-29(33)27(31)18-19-28(22(2)20-24-21-36-23(3)32-24)35-37(30(4,5)6,25-14-10-8-11-15-25)26-16-12-9-13-17-26/h8-18,20-21,28H,7,19H2,1-6H3 |
| InChIKey | CASJLOLWLXOXKI-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.23 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|