C44H47INOPSSi — CID 22244431
[(E)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-enyl]-triphenylphosphanium iodide (PubChem CID 22244431) has the molecular formula C44H47INOPSSi and a molecular weight of 823.90 g/mol. Its IUPAC name is [(E)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-enyl]-triphenylphosphanium iodide.
| Compound Name | [(E)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-enyl]-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 22244431 |
| Molecular Formula | C44H47INOPSSi |
| Molecular Weight | 823.90 g/mol |
| Exact Mass | 823.19 |
| IUPAC Name | [(E)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-enyl]-triphenylphosphanium iodide |
| SMILES | C/C(=C\c1csc(C)n1)C(CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.[I-] |
| InChI | InChI=1S/C44H47NOPSSi.HI/c1-35(33-37-34-48-36(2)45-37)43(46-49(44(3,4)5,41-27-17-9-18-28-41)42-29-19-10-20-30-42)31-32-47(38-21-11-6-12-22-38,39-23-13-7-14-24-39)40-25-15-8-16-26-40;/h6-30,33-34,43H,31-32H2,1-5H3;1H/q+1;/p-1/b35-33+; |
| InChIKey | JKMARZZXNGGHQS-SPUIRANWSA-M |
| XLogP | 6.19 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.90 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|