C45H47NOPSi+ — CID 173129284
[(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-pyridin-3-ylpent-4-enyl]-triphenylphosphanium (PubChem CID 173129284) has the molecular formula C45H47NOPSi+ and a molecular weight of 676.94 g/mol. Its IUPAC name is [(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-pyridin-3-ylpent-4-enyl]-triphenylphosphanium.
| Compound Name | [(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-pyridin-3-ylpent-4-enyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 173129284 |
| Molecular Formula | C45H47NOPSi+ |
| Molecular Weight | 676.94 g/mol |
| Exact Mass | 676.32 |
| IUPAC Name | [(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-pyridin-3-ylpent-4-enyl]-triphenylphosphanium |
| SMILES | CC(=Cc1cccnc1)[C@H](CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C45H47NOPSi/c1-37(35-38-21-20-33-46-36-38)44(47-49(45(2,3)4,42-28-16-8-17-29-42)43-30-18-9-19-31-43)32-34-48(39-22-10-5-11-23-39,40-24-12-6-13-25-40)41-26-14-7-15-27-41/h5-31,33,35-36,44H,32,34H2,1-4H3/q+1/t44-/m0/s1 |
| InChIKey | GSPLPZZWXRLRII-SJARJILFSA-N |
| XLogP | 8.81 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.94 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|