C27H32INOSi — CID 68951593
tert-butyl-[(E,3S)-5-iodo-2-methyl-1-pyridin-3-ylpent-1-en-3-yl]oxy-diphenylsilane (PubChem CID 68951593) has the molecular formula C27H32INOSi and a molecular weight of 541.55 g/mol. Its IUPAC name is tert-butyl-[(E,3S)-5-iodo-2-methyl-1-pyridin-3-ylpent-1-en-3-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(E,3S)-5-iodo-2-methyl-1-pyridin-3-ylpent-1-en-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 68951593 |
| Molecular Formula | C27H32INOSi |
| Molecular Weight | 541.55 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | tert-butyl-[(E,3S)-5-iodo-2-methyl-1-pyridin-3-ylpent-1-en-3-yl]oxy-diphenylsilane |
| SMILES | C/C(=C\c1cccnc1)[C@H](CCI)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H32INOSi/c1-22(20-23-12-11-19-29-21-23)26(17-18-28)30-31(27(2,3)4,24-13-7-5-8-14-24)25-15-9-6-10-16-25/h5-16,19-21,26H,17-18H2,1-4H3/b22-20+/t26-/m0/s1 |
| InChIKey | WNWKTEIIMVIKLO-CCISSDKNSA-N |
| XLogP | 6.26 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.55 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|