C27H33NOSi — CID 70199618
tert-butyl-(2-methyl-1-pyridin-3-ylpent-1-en-3-yl)oxy-diphenylsilane (PubChem CID 70199618) has the molecular formula C27H33NOSi and a molecular weight of 415.65 g/mol. Its IUPAC name is tert-butyl-(2-methyl-1-pyridin-3-ylpent-1-en-3-yl)oxy-diphenylsilane.
| Compound Name | tert-butyl-(2-methyl-1-pyridin-3-ylpent-1-en-3-yl)oxy-diphenylsilane |
|---|---|
| PubChem CID | 70199618 |
| Molecular Formula | C27H33NOSi |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | tert-butyl-(2-methyl-1-pyridin-3-ylpent-1-en-3-yl)oxy-diphenylsilane |
| SMILES | CCC(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)=Cc1cccnc1 |
| InChI | InChI=1S/C27H33NOSi/c1-6-26(22(2)20-23-14-13-19-28-21-23)29-30(27(3,4)5,24-15-9-7-10-16-24)25-17-11-8-12-18-25/h7-21,26H,6H2,1-5H3 |
| InChIKey | JUMNBXYYCZGHJA-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|