C31H38OSi — CID 15321594
tert-butyl-[(5E)-2,5-dimethyl-7-phenylhepta-1,5-dien-4-yl]oxy-diphenylsilane (PubChem CID 15321594) has the molecular formula C31H38OSi and a molecular weight of 454.73 g/mol. Its IUPAC name is tert-butyl-[(5E)-2,5-dimethyl-7-phenylhepta-1,5-dien-4-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(5E)-2,5-dimethyl-7-phenylhepta-1,5-dien-4-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 15321594 |
| Molecular Formula | C31H38OSi |
| Molecular Weight | 454.73 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | tert-butyl-[(5E)-2,5-dimethyl-7-phenylhepta-1,5-dien-4-yl]oxy-diphenylsilane |
| SMILES | C=C(C)CC(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)/C(C)=C/Cc1ccccc1 |
| InChI | InChI=1S/C31H38OSi/c1-25(2)24-30(26(3)22-23-27-16-10-7-11-17-27)32-33(31(4,5)6,28-18-12-8-13-19-28)29-20-14-9-15-21-29/h7-22,30H,1,23-24H2,2-6H3/b26-22+ |
| InChIKey | JDBOANBJFPVKOI-XTCLZLMSSA-N |
| XLogP | 7.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.73 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|