C43H58O3Si2 — CID 157329912
(3R)-3-[tert-butyl(diphenyl)silyl]oxypentan-2-one;tert-butyl-[(3R)-2-methylpent-1-en-3-yl]oxy-diphenylsilane (PubChem CID 157329912) has the molecular formula C43H58O3Si2 and a molecular weight of 679.11 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(diphenyl)silyl]oxypentan-2-one;tert-butyl-[(3R)-2-methylpent-1-en-3-yl]oxy-diphenylsilane.
| Compound Name | (3R)-3-[tert-butyl(diphenyl)silyl]oxypentan-2-one;tert-butyl-[(3R)-2-methylpent-1-en-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 157329912 |
| Molecular Formula | C43H58O3Si2 |
| Molecular Weight | 679.11 g/mol |
| Exact Mass | 678.39 |
| IUPAC Name | (3R)-3-[tert-butyl(diphenyl)silyl]oxypentan-2-one;tert-butyl-[(3R)-2-methylpent-1-en-3-yl]oxy-diphenylsilane |
| SMILES | C=C(C)[C@@H](CC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.CC[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)=O |
| InChI | InChI=1S/C22H30OSi.C21H28O2Si/c1-7-21(18(2)3)23-24(22(4,5)6,19-14-10-8-11-15-19)20-16-12-9-13-17-20;1-6-20(17(2)22)23-24(21(3,4)5,18-13-9-7-10-14-18)19-15-11-8-12-16-19/h8-17,21H,2,7H2,1,3-6H3;7-16,20H,6H2,1-5H3/t21-;20-/m11/s1 |
| InChIKey | BFDYNXAKZUYGHS-NWORTSARSA-N |
| XLogP | 8.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.11 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|