C24H32O5Si — CID 102212939
dimethyl (2R,3R)-2-[tert-butyl(diphenyl)silyl]oxy-3-ethylbutanedioate (PubChem CID 102212939) has the molecular formula C24H32O5Si and a molecular weight of 428.60 g/mol. Its IUPAC name is dimethyl (2R,3R)-2-[tert-butyl(diphenyl)silyl]oxy-3-ethylbutanedioate.
| Compound Name | dimethyl (2R,3R)-2-[tert-butyl(diphenyl)silyl]oxy-3-ethylbutanedioate |
|---|---|
| PubChem CID | 102212939 |
| Molecular Formula | C24H32O5Si |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | dimethyl (2R,3R)-2-[tert-butyl(diphenyl)silyl]oxy-3-ethylbutanedioate |
| SMILES | CC[C@@H](C(=O)OC)[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C24H32O5Si/c1-7-20(22(25)27-5)21(23(26)28-6)29-30(24(2,3)4,18-14-10-8-11-15-18)19-16-12-9-13-17-19/h8-17,20-21H,7H2,1-6H3/t20-,21-/m1/s1 |
| InChIKey | MMDSGXUTROLMJP-NHCUHLMSSA-N |
| XLogP | 3.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|