C26H33NO2SSi — CID 68953491
(E,3R)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-en-1-ol (PubChem CID 68953491) has the molecular formula C26H33NO2SSi and a molecular weight of 451.71 g/mol. Its IUPAC name is (E,3R)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-en-1-ol.
| Compound Name | (E,3R)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-en-1-ol |
|---|---|
| PubChem CID | 68953491 |
| Molecular Formula | C26H33NO2SSi |
| Molecular Weight | 451.71 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | (E,3R)-3-[tert-butyl(diphenyl)silyl]oxy-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-en-1-ol |
| SMILES | C/C(=C\c1csc(C)n1)[C@@H](CCO)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H33NO2SSi/c1-20(18-22-19-30-21(2)27-22)25(16-17-28)29-31(26(3,4)5,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-15,18-19,25,28H,16-17H2,1-5H3/b20-18+/t25-/m1/s1 |
| InChIKey | AHPKZABTMDHASJ-MHOQICJOSA-N |
| XLogP | 5.18 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.71 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|