C27H33NO2SSi — CID 11328743
(E,2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-enal (PubChem CID 11328743) has the molecular formula C27H33NO2SSi and a molecular weight of 463.72 g/mol. Its IUPAC name is (E,2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-enal.
| Compound Name | (E,2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-enal |
|---|---|
| PubChem CID | 11328743 |
| Molecular Formula | C27H33NO2SSi |
| Molecular Weight | 463.72 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | (E,2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-enal |
| SMILES | C/C(=C\c1csc(C)n1)[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)C=O |
| InChI | InChI=1S/C27H33NO2SSi/c1-20(17-23-19-31-22(3)28-23)26(21(2)18-29)30-32(27(4,5)6,24-13-9-7-10-14-24)25-15-11-8-12-16-25/h7-19,21,26H,1-6H3/b20-17+/t21-,26+/m0/s1 |
| InChIKey | MDWBRENXANAOIN-QEQSFVKJSA-N |
| XLogP | 5.64 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.72 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|