C13H11NO2S — CID 43343998
(Z)-3-(2-methyl-1,3-thiazol-4-yl)-2-phenylprop-2-enoic acid (PubChem CID 43343998) has the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. Its IUPAC name is (Z)-3-(2-methyl-1,3-thiazol-4-yl)-2-phenylprop-2-enoic acid.
| Compound Name | (Z)-3-(2-methyl-1,3-thiazol-4-yl)-2-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 43343998 |
| Molecular Formula | C13H11NO2S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | (Z)-3-(2-methyl-1,3-thiazol-4-yl)-2-phenylprop-2-enoic acid |
| SMILES | Cc1nc(/C=C(\C(=O)O)c2ccccc2)cs1 |
| InChI | InChI=1S/C13H11NO2S/c1-9-14-11(8-17-9)7-12(13(15)16)10-5-3-2-4-6-10/h2-8H,1H3,(H,15,16)/b12-7- |
| InChIKey | HBIAFVRZFIWZEM-GHXNOFRVSA-N |
| XLogP | 3.08 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|