About (Z)-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2,3-diphenylprop-2-enamide
(Z)-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2,3-diphenylprop-2-enamide (PubChem CID 108760126) has the molecular formula C21H20N2OS
and a molecular weight of 348.47 g/mol. Its IUPAC name is (Z)-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2,3-diphenylprop-2-enamide.
Molecular Properties
| Compound Name | (Z)-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2,3-diphenylprop-2-enamide |
| PubChem CID | 108760126 |
| Molecular Formula | C21H20N2OS |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (Z)-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2,3-diphenylprop-2-enamide |
| SMILES | Cc1nc(C(C)NC(=O)/C(=C\c2ccccc2)c2ccccc2)cs1 |
| InChI | InChI=1S/C21H20N2OS/c1-15(20-14-25-16(2)23-20)22-21(24)19(18-11-7-4-8-12-18)13-17-9-5-3-6-10-17/h3-15H,1-2H3,(H,22,24)/b19-13- |
| InChIKey | GYJHIADFJRYERB-UYRXBGFRSA-N |
| XLogP | 4.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2,3-diphenylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2,3-diphenylprop-2-enamide?
The IUPAC name of (Z)-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2,3-diphenylprop-2-enamide (CID 108760126) is (Z)-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2,3-diphenylprop-2-enamide.
What is the SMILES notation for (Z)-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2,3-diphenylprop-2-enamide?
The canonical SMILES for (Z)-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2,3-diphenylprop-2-enamide is Cc1nc(C(C)NC(=O)/C(=C\c2ccccc2)c2ccccc2)cs1.
What is the InChIKey of (Z)-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2,3-diphenylprop-2-enamide?
The InChIKey is GYJHIADFJRYERB-UYRXBGFRSA-N. The full InChI is InChI=1S/C21H20N2OS/c1-15(20-14-25-16(2)23-20)22-21(24)19(18-11-7-4-8-12-18)13-17-9-5-3-6-10-17/h3-15H,1-2H3,(H,22,24)/b19-13-.
What are the key properties of (Z)-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2,3-diphenylprop-2-enamide?
(Z)-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2,3-diphenylprop-2-enamide has a molecular weight of 348.47 g/mol, XLogP of 4.87, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-2,3-diphenylprop-2-enamide is sourced from PubChem (CID 108760126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).