C25H25NO — CID 92683153
(E)-N-[(1S)-1-(2,4-dimethylphenyl)ethyl]-2,3-diphenylprop-2-enamide (PubChem CID 92683153) has the molecular formula C25H25NO and a molecular weight of 355.48 g/mol. Its IUPAC name is (E)-N-[(1S)-1-(2,4-dimethylphenyl)ethyl]-2,3-diphenylprop-2-enamide.
| Compound Name | (E)-N-[(1S)-1-(2,4-dimethylphenyl)ethyl]-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 92683153 |
| Molecular Formula | C25H25NO |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (E)-N-[(1S)-1-(2,4-dimethylphenyl)ethyl]-2,3-diphenylprop-2-enamide |
| SMILES | Cc1ccc([C@H](C)NC(=O)/C(=C/c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C25H25NO/c1-18-14-15-23(19(2)16-18)20(3)26-25(27)24(22-12-8-5-9-13-22)17-21-10-6-4-7-11-21/h4-17,20H,1-3H3,(H,26,27)/b24-17+/t20-/m0/s1 |
| InChIKey | GIEPDQVFHHFDIS-MHIQDMOBSA-N |
| XLogP | 5.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|