C20H23NO — CID 133240414
(E)-N-(3-methylbutan-2-yl)-2,3-diphenylprop-2-enamide (PubChem CID 133240414) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (E)-N-(3-methylbutan-2-yl)-2,3-diphenylprop-2-enamide.
| Compound Name | (E)-N-(3-methylbutan-2-yl)-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 133240414 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (E)-N-(3-methylbutan-2-yl)-2,3-diphenylprop-2-enamide |
| SMILES | CC(C)C(C)NC(=O)/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H23NO/c1-15(2)16(3)21-20(22)19(18-12-8-5-9-13-18)14-17-10-6-4-7-11-17/h4-16H,1-3H3,(H,21,22)/b19-14+ |
| InChIKey | QWJRONFQMKEMAT-XMHGGMMESA-N |
| XLogP | 4.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|