C8H9NO2S — CID 91864729
(E)-2-methyl-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoic acid (PubChem CID 91864729) has the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. Its IUPAC name is (E)-2-methyl-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoic acid.
| Compound Name | (E)-2-methyl-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 91864729 |
| Molecular Formula | C8H9NO2S |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | (E)-2-methyl-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoic acid |
| SMILES | C/C(=C\c1csc(C)n1)C(=O)O |
| InChI | InChI=1S/C8H9NO2S/c1-5(8(10)11)3-7-4-12-6(2)9-7/h3-4H,1-2H3,(H,10,11)/b5-3+ |
| InChIKey | UYPBUWRREYTSFP-HWKANZROSA-N |
| XLogP | 1.94 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|