C7H6ClNOS — CID 57124336
2-chloro-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enal (PubChem CID 57124336) has the molecular formula C7H6ClNOS and a molecular weight of 187.65 g/mol. Its IUPAC name is 2-chloro-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enal.
| Compound Name | 2-chloro-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enal |
|---|---|
| PubChem CID | 57124336 |
| Molecular Formula | C7H6ClNOS |
| Molecular Weight | 187.65 g/mol |
| Exact Mass | 186.99 |
| IUPAC Name | 2-chloro-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enal |
| SMILES | Cc1nc(C=C(Cl)C=O)cs1 |
| InChI | InChI=1S/C7H6ClNOS/c1-5-9-7(4-11-5)2-6(8)3-10/h2-4H,1H3 |
| InChIKey | VEFCKGKBKIYHKO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.65 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|