C9H13NO2S — CID 158730051
2-methyl-1,3-thiazole-4-carbaldehyde;oxolane (PubChem CID 158730051) has the molecular formula C9H13NO2S and a molecular weight of 199.28 g/mol. Its IUPAC name is 2-methyl-1,3-thiazole-4-carbaldehyde;oxolane.
| Compound Name | 2-methyl-1,3-thiazole-4-carbaldehyde;oxolane |
|---|---|
| PubChem CID | 158730051 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 2-methyl-1,3-thiazole-4-carbaldehyde;oxolane |
| SMILES | C1CCOC1.Cc1nc(C=O)cs1 |
| InChI | InChI=1S/C5H5NOS.C4H8O/c1-4-6-5(2-7)3-8-4;1-2-4-5-3-1/h2-3H,1H3;1-4H2 |
| InChIKey | IKZCWBOWLNOQBS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|