C6H6ClNS — CID 141028514
4-(2-chloroethenyl)-2-methyl-1,3-thiazole (PubChem CID 141028514) has the molecular formula C6H6ClNS and a molecular weight of 159.64 g/mol. Its IUPAC name is 4-(2-chloroethenyl)-2-methyl-1,3-thiazole.
| Compound Name | 4-(2-chloroethenyl)-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 141028514 |
| Molecular Formula | C6H6ClNS |
| Molecular Weight | 159.64 g/mol |
| Exact Mass | 158.99 |
| IUPAC Name | 4-(2-chloroethenyl)-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(C=CCl)cs1 |
| InChI | InChI=1S/C6H6ClNS/c1-5-8-6(2-3-7)4-9-5/h2-4H,1H3 |
| InChIKey | QDPVUVCORKDDJH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.64 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |