C7H9NOS — CID 22244458
(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-en-1-ol (PubChem CID 22244458) has the molecular formula C7H9NOS and a molecular weight of 155.22 g/mol. Its IUPAC name is (E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-en-1-ol.
| Compound Name | (E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 22244458 |
| Molecular Formula | C7H9NOS |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.04 |
| IUPAC Name | (E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-en-1-ol |
| SMILES | Cc1nc(/C=C/CO)cs1 |
| InChI | InChI=1S/C7H9NOS/c1-6-8-7(5-10-6)3-2-4-9/h2-3,5,9H,4H2,1H3/b3-2+ |
| InChIKey | UIGVSHFWKRHCSH-NSCUHMNNSA-N |
| XLogP | 1.46 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |