C10H13NOS — CID 11074318
(1E,3S)-1-(2-methyl-1,3-thiazol-4-yl)hexa-1,5-dien-3-ol (PubChem CID 11074318) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is (1E,3S)-1-(2-methyl-1,3-thiazol-4-yl)hexa-1,5-dien-3-ol.
| Compound Name | (1E,3S)-1-(2-methyl-1,3-thiazol-4-yl)hexa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 11074318 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (1E,3S)-1-(2-methyl-1,3-thiazol-4-yl)hexa-1,5-dien-3-ol |
| SMILES | C=CC[C@H](O)/C=C/c1csc(C)n1 |
| InChI | InChI=1S/C10H13NOS/c1-3-4-10(12)6-5-9-7-13-8(2)11-9/h3,5-7,10,12H,1,4H2,2H3/b6-5+/t10-/m0/s1 |
| InChIKey | GCPPJOLVLSHSSZ-PORFMDCZSA-N |
| XLogP | 2.40 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|