C12H16INOS — CID 59922940
(1E,3R,5Z)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-ol (PubChem CID 59922940) has the molecular formula C12H16INOS and a molecular weight of 349.24 g/mol. Its IUPAC name is (1E,3R,5Z)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-ol.
| Compound Name | (1E,3R,5Z)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-ol |
|---|---|
| PubChem CID | 59922940 |
| Molecular Formula | C12H16INOS |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | (1E,3R,5Z)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-ol |
| SMILES | C/C(I)=C/C[C@@H](O)/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C12H16INOS/c1-8(12(15)5-4-9(2)13)6-11-7-16-10(3)14-11/h4,6-7,12,15H,5H2,1-3H3/b8-6+,9-4-/t12-/m1/s1 |
| InChIKey | MOTAOEIUDUJLLZ-KXKBOWKNSA-N |
| XLogP | 3.94 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|