C12H16INOS — CID 91359235
4-[(3S)-6-iodo-3-methoxy-2-methylhexa-1,5-dienyl]-2-methyl-1,3-thiazole (PubChem CID 91359235) has the molecular formula C12H16INOS and a molecular weight of 349.24 g/mol. Its IUPAC name is 4-[(3S)-6-iodo-3-methoxy-2-methylhexa-1,5-dienyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[(3S)-6-iodo-3-methoxy-2-methylhexa-1,5-dienyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 91359235 |
| Molecular Formula | C12H16INOS |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 4-[(3S)-6-iodo-3-methoxy-2-methylhexa-1,5-dienyl]-2-methyl-1,3-thiazole |
| SMILES | CO[C@@H](CC=CI)C(C)=Cc1csc(C)n1 |
| InChI | InChI=1S/C12H16INOS/c1-9(12(15-3)5-4-6-13)7-11-8-16-10(2)14-11/h4,6-8,12H,5H2,1-3H3/t12-/m0/s1 |
| InChIKey | FLRDSNMKDHDUFY-LBPRGKRZSA-N |
| XLogP | 4.21 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|