C14H23NO4S — CID 11514961
(E,3S)-3-(2-methoxyethoxymethoxy)-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-en-1-ol (PubChem CID 11514961) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is (E,3S)-3-(2-methoxyethoxymethoxy)-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-en-1-ol.
| Compound Name | (E,3S)-3-(2-methoxyethoxymethoxy)-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-en-1-ol |
|---|---|
| PubChem CID | 11514961 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (E,3S)-3-(2-methoxyethoxymethoxy)-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-en-1-ol |
| SMILES | COCCOCO[C@@H](CCO)/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C14H23NO4S/c1-11(8-13-9-20-12(2)15-13)14(4-5-16)19-10-18-7-6-17-3/h8-9,14,16H,4-7,10H2,1-3H3/b11-8+/t14-/m0/s1 |
| InChIKey | VQIKCXFDXKSFFQ-ZHZWZMEUSA-N |
| XLogP | 2.24 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|