C16H29NO2SSi — CID 6167478
(E)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-en-1-ol (PubChem CID 6167478) has the molecular formula C16H29NO2SSi and a molecular weight of 327.57 g/mol. Its IUPAC name is (E)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-en-1-ol.
| Compound Name | (E)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-en-1-ol |
|---|---|
| PubChem CID | 6167478 |
| Molecular Formula | C16H29NO2SSi |
| Molecular Weight | 327.57 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (E)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-en-1-ol |
| SMILES | C/C(=C\c1csc(C)n1)C(CCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H29NO2SSi/c1-12(10-14-11-20-13(2)17-14)15(8-9-18)19-21(6,7)16(3,4)5/h10-11,15,18H,8-9H2,1-7H3/b12-10+ |
| InChIKey | WQQIQHITWPPXOO-ZRDIBKRKSA-N |
| XLogP | 4.63 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|