C21H34N2OSSi — CID 11372734
(4Z,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-9-(2-methyl-1,3-thiazol-4-yl)nona-4,8-dienenitrile (PubChem CID 11372734) has the molecular formula C21H34N2OSSi and a molecular weight of 390.67 g/mol. Its IUPAC name is (4Z,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-9-(2-methyl-1,3-thiazol-4-yl)nona-4,8-dienenitrile.
| Compound Name | (4Z,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-9-(2-methyl-1,3-thiazol-4-yl)nona-4,8-dienenitrile |
|---|---|
| PubChem CID | 11372734 |
| Molecular Formula | C21H34N2OSSi |
| Molecular Weight | 390.67 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | (4Z,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-9-(2-methyl-1,3-thiazol-4-yl)nona-4,8-dienenitrile |
| SMILES | C/C(=C/C[C@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/c1csc(C)n1)CCC#N |
| InChI | InChI=1S/C21H34N2OSSi/c1-16(10-9-13-22)11-12-20(24-26(7,8)21(4,5)6)17(2)14-19-15-25-18(3)23-19/h11,14-15,20H,9-10,12H2,1-8H3/b16-11-,17-14+/t20-/m0/s1 |
| InChIKey | PCGMECLBWRXRCT-MEPHXNHESA-N |
| XLogP | 6.89 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.67 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|