C29H55NO2SSi2 — CID 11006034
tert-butyl-[(2S,6Z,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-2,10-dimethyl-11-(2-methyl-1,3-thiazol-4-yl)undeca-6,10-dienoxy]-dimethylsilane (PubChem CID 11006034) has the molecular formula C29H55NO2SSi2 and a molecular weight of 538.00 g/mol. Its IUPAC name is tert-butyl-[(2S,6Z,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-2,10-dimethyl-11-(2-methyl-1,3-thiazol-4-yl)undeca-6,10-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2S,6Z,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-2,10-dimethyl-11-(2-methyl-1,3-thiazol-4-yl)undeca-6,10-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11006034 |
| Molecular Formula | C29H55NO2SSi2 |
| Molecular Weight | 538.00 g/mol |
| Exact Mass | 537.35 |
| IUPAC Name | tert-butyl-[(2S,6Z,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-2,10-dimethyl-11-(2-methyl-1,3-thiazol-4-yl)undeca-6,10-dienoxy]-dimethylsilane |
| SMILES | C/C(=C\c1csc(C)n1)[C@H](C/C=C\CCC[C@H](C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H55NO2SSi2/c1-23(21-31-34(10,11)28(4,5)6)18-16-14-15-17-19-27(32-35(12,13)29(7,8)9)24(2)20-26-22-33-25(3)30-26/h15,17,20,22-23,27H,14,16,18-19,21H2,1-13H3/b17-15-,24-20+/t23-,27-/m0/s1 |
| InChIKey | HMIUHMXTMZGMGV-ULNPPAAGSA-N |
| XLogP | 10.02 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.00 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|