C27H47NO3SSi — CID 11225652
tert-butyl-[(1E,3S,5Z,10S)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)undeca-1,5-dien-3-yl]oxy-dimethylsilane (PubChem CID 11225652) has the molecular formula C27H47NO3SSi and a molecular weight of 493.83 g/mol. Its IUPAC name is tert-butyl-[(1E,3S,5Z,10S)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)undeca-1,5-dien-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1E,3S,5Z,10S)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)undeca-1,5-dien-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11225652 |
| Molecular Formula | C27H47NO3SSi |
| Molecular Weight | 493.83 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | tert-butyl-[(1E,3S,5Z,10S)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)undeca-1,5-dien-3-yl]oxy-dimethylsilane |
| SMILES | C/C(=C\c1csc(C)n1)[C@H](C/C=C\CCC[C@H](C)[C@@H]1COC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H47NO3SSi/c1-20(25-18-29-27(7,8)30-25)15-13-11-12-14-16-24(31-33(9,10)26(4,5)6)21(2)17-23-19-32-22(3)28-23/h12,14,17,19-20,24-25H,11,13,15-16,18H2,1-10H3/b14-12-,21-17+/t20-,24-,25-/m0/s1 |
| InChIKey | ZCJMGRMJCFVWRA-SDONHTGZSA-N |
| XLogP | 8.15 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.83 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|