C24H41NO3SSi — CID 135710922
(2R)-5-[(2R,3S)-3-[(E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]-2-methylpentanal (PubChem CID 135710922) has the molecular formula C24H41NO3SSi and a molecular weight of 451.75 g/mol. Its IUPAC name is (2R)-5-[(2R,3S)-3-[(E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]-2-methylpentanal.
| Compound Name | (2R)-5-[(2R,3S)-3-[(E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]-2-methylpentanal |
|---|---|
| PubChem CID | 135710922 |
| Molecular Formula | C24H41NO3SSi |
| Molecular Weight | 451.75 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | (2R)-5-[(2R,3S)-3-[(E,2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]-2-methylpentanal |
| SMILES | C/C(=C\c1csc(C)n1)[C@H](C[C@@H]1O[C@]1(C)CCC[C@@H](C)C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H41NO3SSi/c1-17(15-26)11-10-12-24(7)22(27-24)14-21(28-30(8,9)23(4,5)6)18(2)13-20-16-29-19(3)25-20/h13,15-17,21-22H,10-12,14H2,1-9H3/b18-13+/t17-,21+,22+,24-/m1/s1 |
| InChIKey | SKVPYTMIXRSLTC-PVUMIABLSA-N |
| XLogP | 6.80 |
| TPSA | 51.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.75 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|