C28H46N2O5S — CID 131801289
(3S,6R,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyl-11-[(2R,3S)-2-methyl-3-[(E,2S)-3-methyl-2-(methylamino)-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]oxiran-2-yl]-5-oxoundecanal (PubChem CID 131801289) has the molecular formula C28H46N2O5S and a molecular weight of 522.75 g/mol. Its IUPAC name is (3S,6R,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyl-11-[(2R,3S)-2-methyl-3-[(E,2S)-3-methyl-2-(methylamino)-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]oxiran-2-yl]-5-oxoundecanal.
| Compound Name | (3S,6R,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyl-11-[(2R,3S)-2-methyl-3-[(E,2S)-3-methyl-2-(methylamino)-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]oxiran-2-yl]-5-oxoundecanal |
|---|---|
| PubChem CID | 131801289 |
| Molecular Formula | C28H46N2O5S |
| Molecular Weight | 522.75 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | (3S,6R,7S,8S)-3,7-dihydroxy-4,4,6,8-tetramethyl-11-[(2R,3S)-2-methyl-3-[(E,2S)-3-methyl-2-(methylamino)-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]oxiran-2-yl]-5-oxoundecanal |
| SMILES | CN[C@@H](C[C@@H]1O[C@]1(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC=O)/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C28H46N2O5S/c1-17(25(33)19(3)26(34)27(5,6)23(32)11-13-31)10-9-12-28(7)24(35-28)15-22(29-8)18(2)14-21-16-36-20(4)30-21/h13-14,16-17,19,22-25,29,32-33H,9-12,15H2,1-8H3/b18-14+/t17-,19+,22-,23-,24-,25-,28+/m0/s1 |
| InChIKey | MZVSGQWELVFHKK-GLBAYIFESA-N |
| XLogP | 4.34 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.75 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|