C27H45NO6S — CID 21341837
(12Z,16E)-1,1,3,7,15-pentahydroxy-4,4,6,8,12,16-hexamethyl-17-(2-methyl-1,3-thiazol-4-yl)heptadeca-12,16-dien-5-one (PubChem CID 21341837) has the molecular formula C27H45NO6S and a molecular weight of 511.73 g/mol. Its IUPAC name is (12Z,16E)-1,1,3,7,15-pentahydroxy-4,4,6,8,12,16-hexamethyl-17-(2-methyl-1,3-thiazol-4-yl)heptadeca-12,16-dien-5-one.
| Compound Name | (12Z,16E)-1,1,3,7,15-pentahydroxy-4,4,6,8,12,16-hexamethyl-17-(2-methyl-1,3-thiazol-4-yl)heptadeca-12,16-dien-5-one |
|---|---|
| PubChem CID | 21341837 |
| Molecular Formula | C27H45NO6S |
| Molecular Weight | 511.73 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | (12Z,16E)-1,1,3,7,15-pentahydroxy-4,4,6,8,12,16-hexamethyl-17-(2-methyl-1,3-thiazol-4-yl)heptadeca-12,16-dien-5-one |
| SMILES | C/C(=C/CC(O)/C(C)=C/c1csc(C)n1)CCCC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(O)O |
| InChI | InChI=1S/C27H45NO6S/c1-16(11-12-22(29)18(3)13-21-15-35-20(5)28-21)9-8-10-17(2)25(33)19(4)26(34)27(6,7)23(30)14-24(31)32/h11,13,15,17,19,22-25,29-33H,8-10,12,14H2,1-7H3/b16-11-,18-13+ |
| InChIKey | GDPFTHUSDOLYGN-ITGPROBPSA-N |
| XLogP | 4.01 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.73 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|