C24H43NO2SSi — CID 22559383
(1E,5Z)-11-[tert-butyl(dimethyl)silyl]oxy-2,6,10-trimethyl-1-(2-methyl-1,3-thiazol-4-yl)undeca-1,5-dien-3-ol (PubChem CID 22559383) has the molecular formula C24H43NO2SSi and a molecular weight of 437.77 g/mol. Its IUPAC name is (1E,5Z)-11-[tert-butyl(dimethyl)silyl]oxy-2,6,10-trimethyl-1-(2-methyl-1,3-thiazol-4-yl)undeca-1,5-dien-3-ol.
| Compound Name | (1E,5Z)-11-[tert-butyl(dimethyl)silyl]oxy-2,6,10-trimethyl-1-(2-methyl-1,3-thiazol-4-yl)undeca-1,5-dien-3-ol |
|---|---|
| PubChem CID | 22559383 |
| Molecular Formula | C24H43NO2SSi |
| Molecular Weight | 437.77 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | (1E,5Z)-11-[tert-butyl(dimethyl)silyl]oxy-2,6,10-trimethyl-1-(2-methyl-1,3-thiazol-4-yl)undeca-1,5-dien-3-ol |
| SMILES | C/C(=C/CC(O)/C(C)=C/c1csc(C)n1)CCCC(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H43NO2SSi/c1-18(11-10-12-19(2)16-27-29(8,9)24(5,6)7)13-14-23(26)20(3)15-22-17-28-21(4)25-22/h13,15,17,19,23,26H,10-12,14,16H2,1-9H3/b18-13-,20-15+ |
| InChIKey | AJIXFROFTDICOV-WJUDDHBZSA-N |
| XLogP | 7.38 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.77 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|