C33H56BrNO5SSi — CID 72723113
[(1E,3S,5Z,10S)-11-hydroxy-2,6,10-trimethyl-1-(2-methyl-1,3-thiazol-4-yl)undeca-1,5-dien-3-yl] (3S)-6-bromo-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-5-oxoheptanoate (PubChem CID 72723113) has the molecular formula C33H56BrNO5SSi and a molecular weight of 686.87 g/mol. Its IUPAC name is [(1E,3S,5Z,10S)-11-hydroxy-2,6,10-trimethyl-1-(2-methyl-1,3-thiazol-4-yl)undeca-1,5-dien-3-yl] (3S)-6-bromo-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-5-oxoheptanoate.
| Compound Name | [(1E,3S,5Z,10S)-11-hydroxy-2,6,10-trimethyl-1-(2-methyl-1,3-thiazol-4-yl)undeca-1,5-dien-3-yl] (3S)-6-bromo-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-5-oxoheptanoate |
|---|---|
| PubChem CID | 72723113 |
| Molecular Formula | C33H56BrNO5SSi |
| Molecular Weight | 686.87 g/mol |
| Exact Mass | 685.28 |
| IUPAC Name | [(1E,3S,5Z,10S)-11-hydroxy-2,6,10-trimethyl-1-(2-methyl-1,3-thiazol-4-yl)undeca-1,5-dien-3-yl] (3S)-6-bromo-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-5-oxoheptanoate |
| SMILES | C/C(=C/C[C@H](OC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)C(C)Br)/C(C)=C/c1csc(C)n1)CCC[C@H](C)CO |
| InChI | InChI=1S/C33H56BrNO5SSi/c1-22(14-13-15-23(2)20-36)16-17-28(24(3)18-27-21-41-26(5)35-27)39-30(37)19-29(33(9,10)31(38)25(4)34)40-42(11,12)32(6,7)8/h16,18,21,23,25,28-29,36H,13-15,17,19-20H2,1-12H3/b22-16-,24-18+/t23-,25?,28-,29-/m0/s1 |
| InChIKey | FOMSWAAUXIAFDS-VWQDARGESA-N |
| XLogP | 9.06 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.87 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|