C46H83NO6SSi3 — CID 90948569
methyl (3S,6R,7S,8S,15S)-3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,12,16-hexamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxoheptadeca-12,16-dien-9-ynoate (PubChem CID 90948569) has the molecular formula C46H83NO6SSi3 and a molecular weight of 862.50 g/mol. Its IUPAC name is methyl (3S,6R,7S,8S,15S)-3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,12,16-hexamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxoheptadeca-12,16-dien-9-ynoate.
| Compound Name | methyl (3S,6R,7S,8S,15S)-3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,12,16-hexamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxoheptadeca-12,16-dien-9-ynoate |
|---|---|
| PubChem CID | 90948569 |
| Molecular Formula | C46H83NO6SSi3 |
| Molecular Weight | 862.50 g/mol |
| Exact Mass | 861.52 |
| IUPAC Name | methyl (3S,6R,7S,8S,15S)-3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,12,16-hexamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxoheptadeca-12,16-dien-9-ynoate |
| SMILES | COC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C#CCC(C)=CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)=Cc1csc(C)n1 |
| InChI | InChI=1S/C46H83NO6SSi3/c1-32(27-28-38(51-55(18,19)43(6,7)8)34(3)29-37-31-54-36(5)47-37)25-24-26-33(2)41(53-57(22,23)45(12,13)14)35(4)42(49)46(15,16)39(30-40(48)50-17)52-56(20,21)44(9,10)11/h27,29,31,33,35,38-39,41H,25,28,30H2,1-23H3/t33-,35+,38-,39-,41-/m0/s1 |
| InChIKey | XIEQJVALZAVESK-FZQOIACBSA-N |
| XLogP | 13.19 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.50 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|