C26H40BrNO4S2 — CID 58875084
[(1E,3S,5Z,10S)-11-hydroxy-2,6,10-trimethyl-1-(2-methyl-1,3-thiazol-4-yl)undeca-1,5-dien-3-yl] 2-(4-bromo-2-methyl-3-oxopentan-2-yl)sulfanylacetate (PubChem CID 58875084) has the molecular formula C26H40BrNO4S2 and a molecular weight of 574.65 g/mol. Its IUPAC name is [(1E,3S,5Z,10S)-11-hydroxy-2,6,10-trimethyl-1-(2-methyl-1,3-thiazol-4-yl)undeca-1,5-dien-3-yl] 2-(4-bromo-2-methyl-3-oxopentan-2-yl)sulfanylacetate.
| Compound Name | [(1E,3S,5Z,10S)-11-hydroxy-2,6,10-trimethyl-1-(2-methyl-1,3-thiazol-4-yl)undeca-1,5-dien-3-yl] 2-(4-bromo-2-methyl-3-oxopentan-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 58875084 |
| Molecular Formula | C26H40BrNO4S2 |
| Molecular Weight | 574.65 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | [(1E,3S,5Z,10S)-11-hydroxy-2,6,10-trimethyl-1-(2-methyl-1,3-thiazol-4-yl)undeca-1,5-dien-3-yl] 2-(4-bromo-2-methyl-3-oxopentan-2-yl)sulfanylacetate |
| SMILES | C/C(=C/C[C@H](OC(=O)CSC(C)(C)C(=O)C(C)Br)/C(C)=C/c1csc(C)n1)CCC[C@H](C)CO |
| InChI | InChI=1S/C26H40BrNO4S2/c1-17(9-8-10-18(2)14-29)11-12-23(19(3)13-22-15-33-21(5)28-22)32-24(30)16-34-26(6,7)25(31)20(4)27/h11,13,15,18,20,23,29H,8-10,12,14,16H2,1-7H3/b17-11-,19-13+/t18-,20?,23-/m0/s1 |
| InChIKey | QXOPFRCVZNCHCK-RMEKRRQSSA-N |
| XLogP | 6.77 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.65 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|