C28H45NO5 — CID 57118960
(3S,6R,7S,8S,15S)-1,3,7,15-tetrahydroxy-4,4,6,8,12,16-hexamethyl-17-pyridin-4-ylheptadeca-12,16-dien-5-one (PubChem CID 57118960) has the molecular formula C28H45NO5 and a molecular weight of 475.67 g/mol. Its IUPAC name is (3S,6R,7S,8S,15S)-1,3,7,15-tetrahydroxy-4,4,6,8,12,16-hexamethyl-17-pyridin-4-ylheptadeca-12,16-dien-5-one.
| Compound Name | (3S,6R,7S,8S,15S)-1,3,7,15-tetrahydroxy-4,4,6,8,12,16-hexamethyl-17-pyridin-4-ylheptadeca-12,16-dien-5-one |
|---|---|
| PubChem CID | 57118960 |
| Molecular Formula | C28H45NO5 |
| Molecular Weight | 475.67 g/mol |
| Exact Mass | 475.33 |
| IUPAC Name | (3S,6R,7S,8S,15S)-1,3,7,15-tetrahydroxy-4,4,6,8,12,16-hexamethyl-17-pyridin-4-ylheptadeca-12,16-dien-5-one |
| SMILES | CC(=CC[C@H](O)C(C)=Cc1ccncc1)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CCO |
| InChI | InChI=1S/C28H45NO5/c1-19(10-11-24(31)21(3)18-23-12-15-29-16-13-23)8-7-9-20(2)26(33)22(4)27(34)28(5,6)25(32)14-17-30/h10,12-13,15-16,18,20,22,24-26,30-33H,7-9,11,14,17H2,1-6H3/t20-,22+,24-,25-,26-/m0/s1 |
| InChIKey | CFZUEKFUINODJI-ZTQWSDBWSA-N |
| XLogP | 4.32 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.67 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|