C29H49NO4S — CID 142225311
(13Z,17E)-8-hydroxy-18-[2-(hydroxymethyl)-1,3-thiazol-4-yl]-16-methoxy-5,5,7,9,13,17-hexamethyloctadeca-13,17-dien-6-one (PubChem CID 142225311) has the molecular formula C29H49NO4S and a molecular weight of 507.78 g/mol. Its IUPAC name is (13Z,17E)-8-hydroxy-18-[2-(hydroxymethyl)-1,3-thiazol-4-yl]-16-methoxy-5,5,7,9,13,17-hexamethyloctadeca-13,17-dien-6-one.
| Compound Name | (13Z,17E)-8-hydroxy-18-[2-(hydroxymethyl)-1,3-thiazol-4-yl]-16-methoxy-5,5,7,9,13,17-hexamethyloctadeca-13,17-dien-6-one |
|---|---|
| PubChem CID | 142225311 |
| Molecular Formula | C29H49NO4S |
| Molecular Weight | 507.78 g/mol |
| Exact Mass | 507.34 |
| IUPAC Name | (13Z,17E)-8-hydroxy-18-[2-(hydroxymethyl)-1,3-thiazol-4-yl]-16-methoxy-5,5,7,9,13,17-hexamethyloctadeca-13,17-dien-6-one |
| SMILES | CCCCC(C)(C)C(=O)C(C)C(O)C(C)CCC/C(C)=C\CC(OC)/C(C)=C/c1csc(CO)n1 |
| InChI | InChI=1S/C29H49NO4S/c1-9-10-16-29(6,7)28(33)23(5)27(32)21(3)13-11-12-20(2)14-15-25(34-8)22(4)17-24-19-35-26(18-31)30-24/h14,17,19,21,23,25,27,31-32H,9-13,15-16,18H2,1-8H3/b20-14-,22-17+ |
| InChIKey | QDWDZKBOPJHSFG-KCVQBWKQSA-N |
| XLogP | 6.98 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.78 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|