C27H50O5 — CID 22966964
(12Z,16E)-1-hydroxy-3,7,15-trimethoxy-4,4,6,8,12,16-hexamethyloctadeca-12,16-dien-5-one (PubChem CID 22966964) has the molecular formula C27H50O5 and a molecular weight of 454.69 g/mol. Its IUPAC name is (12Z,16E)-1-hydroxy-3,7,15-trimethoxy-4,4,6,8,12,16-hexamethyloctadeca-12,16-dien-5-one.
| Compound Name | (12Z,16E)-1-hydroxy-3,7,15-trimethoxy-4,4,6,8,12,16-hexamethyloctadeca-12,16-dien-5-one |
|---|---|
| PubChem CID | 22966964 |
| Molecular Formula | C27H50O5 |
| Molecular Weight | 454.69 g/mol |
| Exact Mass | 454.37 |
| IUPAC Name | (12Z,16E)-1-hydroxy-3,7,15-trimethoxy-4,4,6,8,12,16-hexamethyloctadeca-12,16-dien-5-one |
| SMILES | C/C=C(\C)C(C/C=C(/C)CCCC(C)C(OC)C(C)C(=O)C(C)(C)C(CCO)OC)OC |
| InChI | InChI=1S/C27H50O5/c1-11-20(3)23(30-8)16-15-19(2)13-12-14-21(4)25(32-10)22(5)26(29)27(6,7)24(31-9)17-18-28/h11,15,21-25,28H,12-14,16-18H2,1-10H3/b19-15-,20-11+ |
| InChIKey | MLCBJWNNDGVLCW-XZBIXYJGSA-N |
| XLogP | 5.75 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.69 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|