C27H45IO5 — CID 22966956
[(1E)-1-iodo-2-methylhexa-1,5-dien-3-yl] (E)-3,7-dimethoxy-4,4,6,8-tetramethyl-5-oxotetradec-12-enoate (PubChem CID 22966956) has the molecular formula C27H45IO5 and a molecular weight of 576.56 g/mol. Its IUPAC name is [(1E)-1-iodo-2-methylhexa-1,5-dien-3-yl] (E)-3,7-dimethoxy-4,4,6,8-tetramethyl-5-oxotetradec-12-enoate.
| Compound Name | [(1E)-1-iodo-2-methylhexa-1,5-dien-3-yl] (E)-3,7-dimethoxy-4,4,6,8-tetramethyl-5-oxotetradec-12-enoate |
|---|---|
| PubChem CID | 22966956 |
| Molecular Formula | C27H45IO5 |
| Molecular Weight | 576.56 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | [(1E)-1-iodo-2-methylhexa-1,5-dien-3-yl] (E)-3,7-dimethoxy-4,4,6,8-tetramethyl-5-oxotetradec-12-enoate |
| SMILES | C=CCC(OC(=O)CC(OC)C(C)(C)C(=O)C(C)C(OC)C(C)CCC/C=C/C)/C(C)=C/I |
| InChI | InChI=1S/C27H45IO5/c1-10-12-13-14-16-19(3)25(32-9)21(5)26(30)27(6,7)23(31-8)17-24(29)33-22(15-11-2)20(4)18-28/h10-12,18-19,21-23,25H,2,13-17H2,1,3-9H3/b12-10+,20-18+ |
| InChIKey | WNVDJNVNIKGCOH-QPFNBDDSSA-N |
| XLogP | 6.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.56 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|