C31H51F3O5Si — CID 59131085
[(5E)-2-oxo-6-(trifluoromethyl)nona-5,8-dien-3-yl] (3S,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5-oxodec-9-enoate (PubChem CID 59131085) has the molecular formula C31H51F3O5Si and a molecular weight of 588.82 g/mol. Its IUPAC name is [(5E)-2-oxo-6-(trifluoromethyl)nona-5,8-dien-3-yl] (3S,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5-oxodec-9-enoate.
| Compound Name | [(5E)-2-oxo-6-(trifluoromethyl)nona-5,8-dien-3-yl] (3S,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5-oxodec-9-enoate |
|---|---|
| PubChem CID | 59131085 |
| Molecular Formula | C31H51F3O5Si |
| Molecular Weight | 588.82 g/mol |
| Exact Mass | 588.35 |
| IUPAC Name | [(5E)-2-oxo-6-(trifluoromethyl)nona-5,8-dien-3-yl] (3S,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5-oxodec-9-enoate |
| SMILES | C=CC/C(=C\CC(OC(=O)C[C@H](C)C(C)(C)C(=O)C(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=C)C(C)=O)C(F)(F)F |
| InChI | InChI=1S/C31H51F3O5Si/c1-14-16-24(31(32,33)34)17-18-25(23(6)35)38-26(36)19-21(4)30(10,11)28(37)22(5)27(20(3)15-2)39-40(12,13)29(7,8)9/h14-15,17,20-22,25,27H,1-2,16,18-19H2,3-13H3/b24-17+/t20-,21-,22?,25?,27-/m0/s1 |
| InChIKey | JXNFPRJDYVZLJX-WLTXNZMJSA-N |
| XLogP | 8.41 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.82 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|