C38H67NO5SSi2 — CID 102255141
[(1S,3Z)-4-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-3,6-dienyl] (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-oxodec-9-enoate (PubChem CID 102255141) has the molecular formula C38H67NO5SSi2 and a molecular weight of 706.20 g/mol. Its IUPAC name is [(1S,3Z)-4-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-3,6-dienyl] (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-oxodec-9-enoate.
| Compound Name | [(1S,3Z)-4-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-3,6-dienyl] (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-oxodec-9-enoate |
|---|---|
| PubChem CID | 102255141 |
| Molecular Formula | C38H67NO5SSi2 |
| Molecular Weight | 706.20 g/mol |
| Exact Mass | 705.43 |
| IUPAC Name | [(1S,3Z)-4-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-3,6-dienyl] (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-oxodec-9-enoate |
| SMILES | C=CC/C(C)=C\C[C@H](OC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=C)c1csc(C)n1 |
| InChI | InChI=1S/C38H67NO5SSi2/c1-19-21-26(3)22-23-31(30-25-45-29(6)39-30)42-33(40)24-32(43-46(15,16)36(7,8)9)38(13,14)35(41)28(5)34(27(4)20-2)44-47(17,18)37(10,11)12/h19-20,22,25,27-28,31-32,34H,1-2,21,23-24H2,3-18H3/b26-22-/t27-,28+,31-,32-,34-/m0/s1 |
| InChIKey | PJDBIXKJNXDJPK-FCWNRHPISA-N |
| XLogP | 11.17 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.20 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|