C28H49Cl3O7Si — CID 59893340
tert-butyl (3S,6S,7R,8S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8-tetramethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)undec-10-enoate (PubChem CID 59893340) has the molecular formula C28H49Cl3O7Si and a molecular weight of 632.14 g/mol. Its IUPAC name is tert-butyl (3S,6S,7R,8S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8-tetramethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)undec-10-enoate.
| Compound Name | tert-butyl (3S,6S,7R,8S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8-tetramethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)undec-10-enoate |
|---|---|
| PubChem CID | 59893340 |
| Molecular Formula | C28H49Cl3O7Si |
| Molecular Weight | 632.14 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | tert-butyl (3S,6S,7R,8S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8-tetramethyl-5-oxo-7-(2,2,2-trichloroethoxycarbonyloxy)undec-10-enoate |
| SMILES | C=CC[C@H](C)[C@@H](OC(=O)OCC(Cl)(Cl)Cl)[C@H](C)C(=O)C(C)(C)[C@H](CC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H49Cl3O7Si/c1-14-15-18(2)22(36-24(34)35-17-28(29,30)31)19(3)23(33)27(10,11)20(16-21(32)37-25(4,5)6)38-39(12,13)26(7,8)9/h14,18-20,22H,1,15-17H2,2-13H3/t18-,19-,20-,22+/m0/s1 |
| InChIKey | FRRBCBDKLBDSJO-BPBCIEFSSA-N |
| XLogP | 8.44 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.14 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|